cas: 1234615-74-7 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate, 97%, 97% (CAS 1234615-74-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KLV-500mg |
| cas | 1234615-74-7 |
| size | 500mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 928.40 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1710.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS 1234615-74-7) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate. InChIKey: NYBFZFSVBNMCRD-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| InChIKey | NYBFZFSVBNMCRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C2C(=C1F)C=CN2 |
Computed by PubChem (NCBI)