cas: 1234615-74-7 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate, 97% (CAS 1234615-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F498135-100MG |
| cas | 1234615-74-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 500mg | 1507.82 Pln | |
| Fluorochem | 1g | 2809.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS 1234615-74-7) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate. InChIKey: NYBFZFSVBNMCRD-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| InChIKey | NYBFZFSVBNMCRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C2C(=C1F)C=CN2 |
Computed by PubChem (NCBI)