cas: 1400976-17-1 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98% (CAS 1400976-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A477659-100mg |
| cas | 1400976-17-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 581.75 Pln | |
| Ambeed | 5g | 2100.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A477659 |
Methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1400976-17-1) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: RVMVLLXHYRJPOK-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | RVMVLLXHYRJPOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C(=O)OC |
Computed by PubChem (NCBI)