cas: 74733-24-7 — see every product listed under this CAS number, including other names
Methyl 4-formyl-3-methoxybenzoate 97% (CAS 74733-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A567086-100mg |
| cas | 74733-24-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 848.75 Pln | |
| Ambeed | 10g | 1627.50 Pln | |
| Ambeed | 25g | 3413.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A567086 |
Methyl 4-formyl-3-methoxybenzoate (CAS 74733-24-7) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: methyl 4-formyl-3-methoxybenzoate. InChIKey: KCBBJVDPDKULDQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | methyl 4-formyl-3-methoxybenzoate |
| InChIKey | KCBBJVDPDKULDQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)C=O |
Computed by PubChem (NCBI)