cas: 74733-24-7 — see every product listed under this CAS number, including other names
Methyl 4-formyl-3-methoxybenzoate, 97%, 97% (CAS 74733-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116UJ0-100mg |
| cas | 74733-24-7 |
| size | 100mg |
| availability | 24g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1437.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-formyl-3-methoxybenzoate (CAS 74733-24-7) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: methyl 4-formyl-3-methoxybenzoate. InChIKey: KCBBJVDPDKULDQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | methyl 4-formyl-3-methoxybenzoate |
| InChIKey | KCBBJVDPDKULDQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)C=O |
Computed by PubChem (NCBI)