cas: 668970-74-9 — see every product listed under this CAS number, including other names
Methyl 5-(2-fluorophenyl)isoxazole-3-carboxylate, 97%, 97% (CAS 668970-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLSD-100mg |
| cas | 668970-74-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1274.00 Pln | |
| Chemat | 5g | 3088.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-(2-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS 668970-74-9) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: methyl 5-(2-fluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: UJELOQIDIAROPA-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | methyl 5-(2-fluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | UJELOQIDIAROPA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC=CC=C2F |
Computed by PubChem (NCBI)