cas: 497258-29-4 — see every product listed under this CAS number, including other names
Methyl 5-Fluoroindole-3-acetate, 95% (CAS 497258-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A961098-100mg |
| cas | 497258-29-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 935.83 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-(5-fluoro-1H-indol-3-yl)acetate (CAS 497258-29-4) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: methyl 2-(5-fluoro-1H-indol-3-yl)acetate. InChIKey: MFECLAWYWGNXOB-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | methyl 2-(5-fluoro-1H-indol-3-yl)acetate |
| InChIKey | MFECLAWYWGNXOB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CNC2=C1C=C(C=C2)F |
Computed by PubChem (NCBI)