cas: 141772-31-8 — see every product listed under this CAS number, including other names
Methyl 5-amino-2-chloro-4-fluorobenzoate, 98% (CAS 141772-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F335728-100MG |
| cas | 141772-31-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 1205.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-amino-2-chloro-4-fluorobenzoate (CAS 141772-31-8) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: methyl 5-amino-2-chloro-4-fluorobenzoate. InChIKey: GRQLIRSFYJTUQR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | methyl 5-amino-2-chloro-4-fluorobenzoate |
| InChIKey | GRQLIRSFYJTUQR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)F)N |
Computed by PubChem (NCBI)