Methyl 5-bromo-2-chloro-3-nitrobenzoate, 98%
cas: 124371-59-1 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-chloro-3-nitrobenzoate, 98% (CAS 124371-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F621945-100MG |
| cas | 124371-59-1 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 461.31 Pln | |
| Fluorochem | 100g | 1309.97 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 100g | 784.40 Pln | |
| Chemat | 250g | 1782.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Methyl 5-bromo-2-chloro-3-nitrobenzoate (CAS 124371-59-1) is a chemical compound with the molecular formula C8H5BrClNO4 and a molecular weight of 294.48 g/mol. IUPAC name: methyl 5-bromo-2-chloro-3-nitrobenzoate. InChIKey: XVVAOPFGJSBHMS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | methyl 5-bromo-2-chloro-3-nitrobenzoate |
| InChIKey | XVVAOPFGJSBHMS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)