cas: 1153285-33-6 — see every product listed under this CAS number, including other names
Methyl 5-chloro-2-fluoro-3-nitrobenzoate, 98% (CAS 1153285-33-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1142075-1g |
| cas | 1153285-33-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3962.98 Pln | |
| Fluorochem | 100mg | 893.45 Pln | |
| Fluorochem | 250mg | 1263.11 Pln | |
| Fluorochem | 1g | 2476.23 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 5-chloro-2-fluoro-3-nitrobenzoate (CAS 1153285-33-6) is a chemical compound with the molecular formula C8H5ClFNO4 and a molecular weight of 233.58 g/mol. IUPAC name: methyl 5-chloro-2-fluoro-3-nitrobenzoate. InChIKey: HZXZBFRZKGKBFX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO4 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | methyl 5-chloro-2-fluoro-3-nitrobenzoate |
| InChIKey | HZXZBFRZKGKBFX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)