CAS 1820739-83-0 appears in our catalog under these names: Methyl 2-chloro-3-fluoro-6-nitrobenzoate, 95%, Methyl 2–chloro–3–fluoro–6–nitrobenzoate, Methyl 2-chloro-3-fluoro-6-nitrobenzoate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 50mg.
Methyl 2-chloro-3-fluoro-6-nitrobenzoate (CAS 1820739-83-0) is a chemical compound with the molecular formula C8H5ClFNO4 and a molecular weight of 233.58 g/mol. IUPAC name: methyl 2-chloro-3-fluoro-6-nitrobenzoate. InChIKey: QRBHOOOOVVYYAT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO4 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | methyl 2-chloro-3-fluoro-6-nitrobenzoate |
| InChIKey | QRBHOOOOVVYYAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)