Products 1565927-14-1

CAS 1565927-14-1 is the registry number for 2-(4-Chloro-5-fluoro-2-nitrophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(4-chloro-5-fluoro-2-nitrophenyl)acetic acid (CAS 1565927-14-1) is a chemical compound with the molecular formula C8H5ClFNO4 and a molecular weight of 233.58 g/mol. IUPAC name: 2-(4-chloro-5-fluoro-2-nitrophenyl)acetic acid. InChIKey: QSYPRQBMNKAZSN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClFNO4
Molecular weight233.58 g/mol
IUPAC name2-(4-chloro-5-fluoro-2-nitrophenyl)acetic acid
InChIKeyQSYPRQBMNKAZSN-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)Cl)[N+](=O)[O-])CC(=O)O

Computed by PubChem (NCBI)