Products 2713997-58-9
CAS 2713997-58-9 is the registry number for 2-Chloro-5-fluoro-6-methylpyridine-3,4-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-fluoro-6-methylpyridine-3,4-dicarboxylic acid (CAS 2713997-58-9) is a chemical compound with the molecular formula C8H5ClFNO4 and a molecular weight of 233.58 g/mol. IUPAC name: 2-chloro-5-fluoro-6-methylpyridine-3,4-dicarboxylic acid. InChIKey: ILBXAUBSHNJKJH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO4 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | 2-chloro-5-fluoro-6-methylpyridine-3,4-dicarboxylic acid |
| InChIKey | ILBXAUBSHNJKJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)Cl)C(=O)O)C(=O)O)F |
Computed by PubChem (NCBI)