CAS 1070893-15-0 appears in our catalog under these names: 4-Chloro-2-fluoro-5-nitro-benzoic acid methyl ester, 98%, Methyl 4-chloro-2-fluoro-5-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Methyl 4-chloro-2-fluoro-5-nitrobenzoate (CAS 1070893-15-0) is a chemical compound with the molecular formula C8H5ClFNO4 and a molecular weight of 233.58 g/mol. IUPAC name: methyl 4-chloro-2-fluoro-5-nitrobenzoate. InChIKey: RQAOESHTSVXKSI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO4 |
|---|---|
| Molecular weight | 233.58 g/mol |
| IUPAC name | methyl 4-chloro-2-fluoro-5-nitrobenzoate |
| InChIKey | RQAOESHTSVXKSI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)