cas: 5043-79-8 — see every product listed under this CAS number, including other names
Methyl 5-chloro-2-hydroxy-3-nitrobenzoate 98% (CAS 5043-79-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A297959-250mg |
| cas | 5043-79-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1221.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A297959 |
Methyl 5-chloro-2-hydroxy-3-nitrobenzoate (CAS 5043-79-8) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: methyl 5-chloro-2-hydroxy-3-nitrobenzoate. InChIKey: FIUDEVZDUKTMAC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5 |
|---|---|
| Molecular weight | 231.59 g/mol |
| IUPAC name | methyl 5-chloro-2-hydroxy-3-nitrobenzoate |
| InChIKey | FIUDEVZDUKTMAC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)