CAS 68255-77-6 appears in our catalog under these names: 4-Chloro-2-methoxy-5-nitro-benzoic acid, 98%, 4-chloro-2-methoxy-5-nitrobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 10g, 1g.
4-chloro-2-methoxy-5-nitrobenzoic acid (CAS 68255-77-6) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: 4-chloro-2-methoxy-5-nitrobenzoic acid. InChIKey: RSBXOVZBSUWTCT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5 |
|---|---|
| Molecular weight | 231.59 g/mol |
| IUPAC name | 4-chloro-2-methoxy-5-nitrobenzoic acid |
| InChIKey | RSBXOVZBSUWTCT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)