Products 190961-69-4
CAS 190961-69-4 is the registry number for Methyl 2-chloro-4-hydroxy-5-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Methyl 2-chloro-4-hydroxy-5-nitrobenzoate (CAS 190961-69-4) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: methyl 2-chloro-4-hydroxy-5-nitrobenzoate. InChIKey: WPAOCIDALGLUFF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5 |
|---|---|
| Molecular weight | 231.59 g/mol |
| IUPAC name | methyl 2-chloro-4-hydroxy-5-nitrobenzoate |
| InChIKey | WPAOCIDALGLUFF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)