Products 101581-13-9
CAS 101581-13-9 appears in our catalog under these names: 2-Chloro-5-methoxy-4-nitro-benzoic acid, 95%, 2-Chloro-5-methoxy-4-nitrobenzoic acid, 2-Chloro-5-methoxy-4-nitro-benzoic acid, ≥97%, ≥97%, 2-Chloro-5-methoxy-4-nitrobenzoic acid, ≥97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg.
2-chloro-5-methoxy-4-nitrobenzoic acid (CAS 101581-13-9) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: 2-chloro-5-methoxy-4-nitrobenzoic acid. InChIKey: OJMMHUJTCVSTMS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5 |
|---|---|
| Molecular weight | 231.59 g/mol |
| IUPAC name | 2-chloro-5-methoxy-4-nitrobenzoic acid |
| InChIKey | OJMMHUJTCVSTMS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)