Products 1261483-15-1

CAS 1261483-15-1 is the registry number for 2-(4-Chloro-2-nitrophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-chloro-2-nitrophenyl)-2-hydroxyacetic acid (CAS 1261483-15-1) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: 2-(4-chloro-2-nitrophenyl)-2-hydroxyacetic acid. InChIKey: LZWRNAZZVFTRKC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO5
Molecular weight231.59 g/mol
IUPAC name2-(4-chloro-2-nitrophenyl)-2-hydroxyacetic acid
InChIKeyLZWRNAZZVFTRKC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)[N+](=O)[O-])C(C(=O)O)O

Computed by PubChem (NCBI)