cas: 136818-64-9 — see every product listed under this CAS number, including other names
Methyl 5-fluoro-6-methoxy-1H-indole-2-carboxylate (CAS 136818-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234793-100MG |
| cas | 136818-64-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1268.32 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 5-fluoro-6-methoxy-1H-indole-2-carboxylate (CAS 136818-64-9) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: methyl 5-fluoro-6-methoxy-1H-indole-2-carboxylate. InChIKey: PWMIPARPMLHREY-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | methyl 5-fluoro-6-methoxy-1H-indole-2-carboxylate |
| InChIKey | PWMIPARPMLHREY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(NC2=C1)C(=O)OC)F |
Computed by PubChem (NCBI)