cas: 152626-88-5 — see every product listed under this CAS number, including other names
Methyl 5-nitro-1H-indazole-6-carboxylate 95% (CAS 152626-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A822235-250mg |
| cas | 152626-88-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1043.44 Pln | |
| Ambeed | 10g | 1983.50 Pln | |
| Ambeed | 25g | 3891.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A822235 |
Methyl 5-nitro-1H-indazole-6-carboxylate (CAS 152626-88-5) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 5-nitro-1H-indazole-6-carboxylate. InChIKey: DEZHKDZFGIGNPH-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 5-nitro-1H-indazole-6-carboxylate |
| InChIKey | DEZHKDZFGIGNPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)