cas: 152626-88-5 — see every product listed under this CAS number, including other names
Methyl 5-nitro-1H-indazole-6-carboxylate, 97%, 97% (CAS 152626-88-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JU9F-25g |
| cas | 152626-88-5 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 3371.60 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 1096.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-nitro-1H-indazole-6-carboxylate (CAS 152626-88-5) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 5-nitro-1H-indazole-6-carboxylate. InChIKey: DEZHKDZFGIGNPH-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 5-nitro-1H-indazole-6-carboxylate |
| InChIKey | DEZHKDZFGIGNPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)