cas: 59599-49-4 — see every product listed under this CAS number, including other names
Methyl 5-oxo-5,6,7,8-tetrahydronaphthalene-1-carboxylate, 98% (CAS 59599-49-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546887-100MG |
| cas | 59599-49-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 1g | 1486.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-oxo-7,8-dihydro-6H-naphthalene-1-carboxylate (CAS 59599-49-4) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: methyl 5-oxo-7,8-dihydro-6H-naphthalene-1-carboxylate. InChIKey: DFNWPCQCKKLLPR-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | methyl 5-oxo-7,8-dihydro-6H-naphthalene-1-carboxylate |
| InChIKey | DFNWPCQCKKLLPR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1CCCC2=O |
Computed by PubChem (NCBI)