CAS 101563-78-4 appears in our catalog under these names: 4–Benzoyl–5–methyldihydrofuran–2(3H)–one, 4-Benzoyl-5-methyldihydrofuran-2(3h)-one, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.
4-benzoyl-5-methyloxolan-2-one (CAS 101563-78-4) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 4-benzoyl-5-methyloxolan-2-one. InChIKey: VIPSLPMDEOPEDM-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 4-benzoyl-5-methyloxolan-2-one |
| InChIKey | VIPSLPMDEOPEDM-UHFFFAOYSA-N |
| SMILES | CC1C(CC(=O)O1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)