cas: 1095822-24-4 — see every product listed under this CAS number, including other names
Methyl 6,7-dihydro-6-oxo-5H-pyrrolo[2,3-d]pyrimidine-4-carboxylate, 97%, 97% (CAS 1095822-24-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBJE-100mg |
| cas | 1095822-24-4 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 846.80 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 500mg | 2234.00 Pln | |
| Chemat | 1g | 3323.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-4-carboxylate (CAS 1095822-24-4) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: methyl 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-4-carboxylate. InChIKey: BTITZWDWJHRMDJ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | methyl 6-oxo-5,7-dihydropyrrolo[2,3-d]pyrimidine-4-carboxylate |
| InChIKey | BTITZWDWJHRMDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CC(=O)NC2=NC=N1 |
Computed by PubChem (NCBI)