cas: 1167055-86-8 — see every product listed under this CAS number, including other names
Methyl 6-Chloropyrazolo[1,5-A]Pyridine-3-Carboxylate, 97%, 97% (CAS 1167055-86-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111D2P-100mg |
| cas | 1167055-86-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1552.40 Pln | |
| Chemat | 5g | 4528.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-chloropyrazolo[1,5-a]pyridine-3-carboxylate (CAS 1167055-86-8) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 6-chloropyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: KYHPSYGRGQSRPK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 6-chloropyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | KYHPSYGRGQSRPK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC(=CN2N=C1)Cl |
Computed by PubChem (NCBI)