cas: 104685-75-8 — see every product listed under this CAS number, including other names
Methyl 6-amino-5-nitronicotinate, 97% (CAS 104685-75-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F610597-1G |
| cas | 104685-75-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1757.73 Pln | |
| Fluorochem | 10g | 3080.18 Pln | |
| Fluorochem | 25g | 5292.95 Pln | |
| Fluorochem | 250mg | 284.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 6-amino-5-nitropyridine-3-carboxylate (CAS 104685-75-8) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: methyl 6-amino-5-nitropyridine-3-carboxylate. InChIKey: DCFLDKSHKLPIQA-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | methyl 6-amino-5-nitropyridine-3-carboxylate |
| InChIKey | DCFLDKSHKLPIQA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)