cas: 1093880-34-2 — see every product listed under this CAS number, including other names
Methyl 6-chloro-2-fluoronicotinate, 98%, 98% (CAS 1093880-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1100C5-100mg |
| cas | 1093880-34-2 |
| size | 100mg |
| availability | 16g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1144.40 Pln | |
| Chemat | 10g | 2013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-chloro-2-fluoropyridine-3-carboxylate (CAS 1093880-34-2) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: methyl 6-chloro-2-fluoropyridine-3-carboxylate. InChIKey: QDBMCQOUBIVORI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | methyl 6-chloro-2-fluoropyridine-3-carboxylate |
| InChIKey | QDBMCQOUBIVORI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1)Cl)F |
Computed by PubChem (NCBI)