cas: 78686-78-9 — see every product listed under this CAS number, including other names
Methyl 6-chloro-5-fluoronicotinate 98% (CAS 78686-78-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A832731-100mg |
| cas | 78686-78-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3079.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A832731 |
Methyl 6-chloro-5-fluoropyridine-3-carboxylate (CAS 78686-78-9) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: methyl 6-chloro-5-fluoropyridine-3-carboxylate. InChIKey: KDMTVIVGDHCOAH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | methyl 6-chloro-5-fluoropyridine-3-carboxylate |
| InChIKey | KDMTVIVGDHCOAH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Cl)F |
Computed by PubChem (NCBI)