Methyl 6-methyl-2-naphthoate, 97%
cas: 6162-30-7 — see every product listed under this CAS number, including other names
Methyl 6-methyl-2-naphthoate, 97% (CAS 6162-30-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A690823-50mg |
| cas | 6162-30-7 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 526.12 Pln | |
| Ambeed | 100mg | 843.19 Pln | |
| Ambeed | 250mg | 1382.75 Pln | |
| Ambeed | 1g | 3991.56 Pln | |
| Ambeed | 5g | 15756.25 Pln | |
| BLDpharm | 50mg | 558.72 Pln | |
| BLDpharm | 100mg | 903.04 Pln | |
| BLDpharm | 250mg | 1486.17 Pln | |
| BLDpharm | 1g | 4296.29 Pln | |
| BLDpharm | 5g | 16980.71 Pln | |
| Chemat | 50mg | 414.80 Pln | |
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1144.40 Pln | |
| Chemat | 1g | 3088.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 6-methylnaphthalene-2-carboxylate (CAS 6162-30-7) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: methyl 6-methylnaphthalene-2-carboxylate. InChIKey: ZBXAEINYNSCHFO-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | methyl 6-methylnaphthalene-2-carboxylate |
| InChIKey | ZBXAEINYNSCHFO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)
