cas: 210963-94-3 — see every product listed under this CAS number, including other names
Methyl 6-pyrrolidinonicotinate, 98%, 98% (CAS 210963-94-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113L3L-1g |
| cas | 210963-94-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 443.60 Pln | |
| Chemat | 25g | 827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-pyrrolidin-1-ylpyridine-3-carboxylate (CAS 210963-94-3) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 6-pyrrolidin-1-ylpyridine-3-carboxylate. InChIKey: OWOKTZZFJFFUKY-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl 6-pyrrolidin-1-ylpyridine-3-carboxylate |
| InChIKey | OWOKTZZFJFFUKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)N2CCCC2 |
Computed by PubChem (NCBI)