cas: 116047-26-8 — see every product listed under this CAS number, including other names
Methyl 8-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylate, 97% (CAS 116047-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243988-100MG |
| cas | 116047-26-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1570.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate (CAS 116047-26-8) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: methyl 8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate. InChIKey: CIZUNRVGSYFMQM-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | methyl 8-oxo-6,7-dihydro-5H-naphthalene-2-carboxylate |
| InChIKey | CIZUNRVGSYFMQM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCCC2=O)C=C1 |
Computed by PubChem (NCBI)