cas: 14437-03-7 — see every product listed under this CAS number, including other names
Methyl Tosylcarbamate, >98.0%(HPLC)(T) (CAS 14437-03-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2988-1G |
| cas | 14437-03-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 501.89 Pln | |
| TCI | 10g | 3825.95 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Methyl N-(4-methylphenyl)sulfonylcarbamate (CAS 14437-03-7) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: methyl N-(4-methylphenyl)sulfonylcarbamate. InChIKey: KNVDHKOSDVFZTO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | methyl N-(4-methylphenyl)sulfonylcarbamate |
| InChIKey | KNVDHKOSDVFZTO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)OC |
Computed by PubChem (NCBI)