Products 81957-76-8
CAS 81957-76-8 appears in our catalog under these names: Mianserin-D3 0.1 mg/ml in Methanol, Mianserin-d3. Offered by: LoGiCal, MedChemExpress. Available pack sizes: 1ml, 1 mg.
5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene (CAS 81957-76-8) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 267.4 g/mol. IUPAC name: 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene. InChIKey: UEQUQVLFIPOEMF-FIBGUPNXSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 5-(trideuteriomethyl)-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
| InChIKey | UEQUQVLFIPOEMF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN2C(C1)C3=CC=CC=C3CC4=CC=CC=C42 |
Computed by PubChem (NCBI)