CAS 1393922-01-4 appears in our catalog under these names: Millepachine, Millepachine/ 99.28% (existing batch purity), Millepachine 97%, Millepachine, 97%, 97%, Millepachine, 99.55%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 5mg, 1mg, 2mg, 25mg, 50mg, 100mg, 200mg.
(E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 1393922-01-4) is a chemical compound with the molecular formula C22H22O4 and a molecular weight of 350.4 g/mol. IUPAC name: (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: GZUOKKIDYHPTAZ-YRNVUSSQSA-N.
| Molecular formula | C22H22O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | GZUOKKIDYHPTAZ-YRNVUSSQSA-N |
| SMILES | CC1(C=CC2=C(C=CC(=C2O1)C(=O)/C=C/C3=CC=C(C=C3)OC)OC)C |
Computed by PubChem (NCBI)