CAS 62949-79-5 appears in our catalog under these names: Mulberrin (Kuwanon C), Mulberrin/ 98.77% (existing batch purity), Mulberrin 98%, Mulberrin (Standard), 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-en-1-yl)-4H-chromen-4-one, 98%, 98%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-enyl)chromen-4-one (CAS 62949-79-5) is a chemical compound with the molecular formula C25H26O6 and a molecular weight of 422.5 g/mol. IUPAC name: 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-enyl)chromen-4-one. InChIKey: UWQYBLOHTQWSQD-UHFFFAOYSA-N.
| Molecular formula | C25H26O6 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | UWQYBLOHTQWSQD-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=C(C=C(C=C3)O)O)CC=C(C)C)C |
Computed by PubChem (NCBI)