cas: 140-50-1 — see every product listed under this CAS number, including other names
N,N'-1,4-Phenylenebisacetamide, 98% (CAS 140-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F341886-1G |
| cas | 140-50-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 25g | 1153.78 Pln | |
| Fluorochem | 100g | 3783.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(4-acetamidophenyl)acetamide (CAS 140-50-1) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: N-(4-acetamidophenyl)acetamide. InChIKey: KVEDKKLZCJBVNP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | N-(4-acetamidophenyl)acetamide |
| InChIKey | KVEDKKLZCJBVNP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)