cas: 140-50-1 — see every product listed under this CAS number, including other names
N,N'-Diacetyl-1,4-phenylenediamine, >98.0%(GC)(N) (CAS 140-50-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0068-5G |
| cas | 140-50-1 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 265.86 Pln | |
| TCI | 25g | 757.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(N) |
N-(4-acetamidophenyl)acetamide (CAS 140-50-1) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: N-(4-acetamidophenyl)acetamide. InChIKey: KVEDKKLZCJBVNP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | N-(4-acetamidophenyl)acetamide |
| InChIKey | KVEDKKLZCJBVNP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)