cas: 620-81-5 — see every product listed under this CAS number, including other names
N,N'-diphenylethanediamide, 98% (CAS 620-81-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F520434-5G |
| cas | 620-81-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1096.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N,N'-diphenyloxamide (CAS 620-81-5) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: N,N'-diphenyloxamide. InChIKey: FTWUXYZHDFCGSV-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | N,N'-diphenyloxamide |
| InChIKey | FTWUXYZHDFCGSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)