cas: 6422-83-9 — see every product listed under this CAS number, including other names
N,N′-(4-Methyl-1,3-phenylene)bismaleimide, 98% (CAS 6422-83-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F4U3-1g |
| cas | 6422-83-9 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 50g | 184.40 Pln | |
| Chemat | 100g | 270.80 Pln | |
| Chemat | 250g | 477.20 Pln | |
| Chemat | 500g | 820.80 Pln | |
| Chemat | 1kg | 1422.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione (CAS 6422-83-9) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: 1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione. InChIKey: FJKKJQRXSPFNPM-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O4 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione |
| InChIKey | FJKKJQRXSPFNPM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C=CC2=O)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)