Products 1120334-31-7

CAS 1120334-31-7 is the registry number for 7-Nitro-2-phenyl-1h-indole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

7-nitro-2-phenyl-1H-indole-5-carboxylic acid (CAS 1120334-31-7) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: 7-nitro-2-phenyl-1H-indole-5-carboxylic acid. InChIKey: VJPDDMKAPSYDDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10N2O4
Molecular weight282.25 g/mol
IUPAC name7-nitro-2-phenyl-1H-indole-5-carboxylic acid
InChIKeyVJPDDMKAPSYDDQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC3=CC(=CC(=C3N2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)