CAS 348125-25-7 appears in our catalog under these names: 1,3-Dioxo-2-(pyridin-3-ylmethyl)isoindoline-5-carboxylic acid, 95%, 1,3-Dioxo-2-pyridin-3-ylmethyl-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxylic acid (CAS 348125-25-7) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: 1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxylic acid. InChIKey: SMHXCNFVPMENIX-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O4 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxylic acid |
| InChIKey | SMHXCNFVPMENIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)