Products 14182-37-7
CAS 14182-37-7 appears in our catalog under these names: 5-Nitro-3-phenyl-1h-indole-2-carboxylic acid, 95%, 5-Nitro-3-phenyl-1H-indole-2-carboxylic acid, 97% , 5-Nitro-3-phenyl-1H-indole-2-carboxylic acid, 95%, 95%, 5-Nitro-3-phenyl-1H-indole-2-carboxylic acid, 95+%. Offered by: Combi-blocks, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-nitro-3-phenyl-1H-indole-2-carboxylic acid (CAS 14182-37-7) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: 5-nitro-3-phenyl-1H-indole-2-carboxylic acid. InChIKey: BMZNTPXQZKYUKD-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O4 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 5-nitro-3-phenyl-1H-indole-2-carboxylic acid |
| InChIKey | BMZNTPXQZKYUKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC3=C2C=C(C=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)