CAS 6422-83-9 appears in our catalog under these names: 1,1'-(4-Methyl-1,3-phenylene)bis(1H-pyrrole-2,5-dione), 95+%, N,N′-(4-Methyl-1,3-phenylene)bismaleimide, 95.0%, 95.0%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g.
1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione (CAS 6422-83-9) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: 1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione. InChIKey: FJKKJQRXSPFNPM-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O4 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 1-[3-(2,5-dioxopyrrol-1-yl)-4-methylphenyl]pyrrole-2,5-dione |
| InChIKey | FJKKJQRXSPFNPM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C=CC2=O)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)