cas: 325142-97-0 — see every product listed under this CAS number, including other names
N,N-Diethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 325142-97-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1CH-250mg |
| cas | 325142-97-0 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 25g | 1965.20 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
N,N-diethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 325142-97-0) is a chemical compound with the molecular formula C17H26BNO3 and a molecular weight of 303.2 g/mol. IUPAC name: N,N-diethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: XCMONACECYHFCP-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | N,N-diethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | XCMONACECYHFCP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N(CC)CC |
Computed by PubChem (NCBI)