CAS 325142-99-2 appears in our catalog under these names: 4-(N,N-Diethylaminocarbonyl)phenylboronic acid, pinacol ester, 96%, 4–(N,N–Diethylaminocarbonyl)phenylboronic acid, pinacol ester, 4-(N,N-Diethylaminocarbonyl)phenylboronic acid, pinacol ester, 98%, 98%, N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g.
N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 325142-99-2) is a chemical compound with the molecular formula C17H26BNO3 and a molecular weight of 303.2 g/mol. IUPAC name: N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: GGSTYOBAIUYURJ-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | GGSTYOBAIUYURJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N(CC)CC |
Computed by PubChem (NCBI)