CAS 1073354-43-4 appears in our catalog under these names: 2-Cyclohexyloxypyridine-3-boronic acid, pinacol ester, 95%, 2-(Cyclohexyloxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-cyclohexyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073354-43-4) is a chemical compound with the molecular formula C17H26BNO3 and a molecular weight of 303.2 g/mol. IUPAC name: 2-cyclohexyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: RSECBXCZEDVQLZ-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 2-cyclohexyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | RSECBXCZEDVQLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)OC3CCCCC3 |
Computed by PubChem (NCBI)