CAS 2377610-65-4 is the registry number for 3-Methyl-n-(propan-2-yl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-methyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2377610-65-4) is a chemical compound with the molecular formula C17H26BNO3 and a molecular weight of 303.2 g/mol. IUPAC name: 3-methyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: XHELTIPXHDKFFV-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 3-methyl-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | XHELTIPXHDKFFV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)NC(C)C)C |
Computed by PubChem (NCBI)