CAS 2451465-21-5 is the registry number for N-butyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2451465-21-5) is a chemical compound with the molecular formula C17H26BNO3 and a molecular weight of 303.2 g/mol. IUPAC name: N-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: JUBAULLCIUKUTR-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | N-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | JUBAULLCIUKUTR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCCCC |
Computed by PubChem (NCBI)