cas: 2143-87-5 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4'-nitro-[1,1'-biphenyl]-4-amine, ≥98%, ≥98% (CAS 2143-87-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LAJ-200mg |
| cas | 2143-87-5 |
| size | 200mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 328.40 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 3126.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-(4-nitrophenyl)aniline (CAS 2143-87-5) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: N,N-dimethyl-4-(4-nitrophenyl)aniline. InChIKey: PLGALHOPBAVGHQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | N,N-dimethyl-4-(4-nitrophenyl)aniline |
| InChIKey | PLGALHOPBAVGHQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)